n-acetyl-l-methionine n-acetyl-l-methionine
structural formula business number 01dy molecular formula c7h13no3s molecular weight 191.25 label n-acetyl l-methionine, ch3sch2ch2ch(nhcoch3)co2h numbering system physical property data toxicological…
structural formula business number 01dy molecular formula c7h13no3s molecular weight 191.25 label n-acetyl l-methionine, ch3sch2ch2ch(nhcoch3)co2h numbering system physical property data toxicological…